About 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one
4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one (PubChem CID 22173236) has the molecular formula C18H18O
and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one |
| PubChem CID | 22173236 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one |
| SMILES | Cc1cc(C)cc(-c2cccc3c2CC(C)C3=O)c1 |
| InChI | InChI=1S/C18H18O/c1-11-7-12(2)9-14(8-11)15-5-4-6-16-17(15)10-13(3)18(16)19/h4-9,13H,10H2,1-3H3 |
| InChIKey | VRAIKXJERCYSCG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one?
The IUPAC name of 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one (CID 22173236) is 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one.
What is the SMILES notation for 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one?
The canonical SMILES for 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one is Cc1cc(C)cc(-c2cccc3c2CC(C)C3=O)c1.
What is the InChIKey of 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one?
The InChIKey is VRAIKXJERCYSCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O/c1-11-7-12(2)9-14(8-11)15-5-4-6-16-17(15)10-13(3)18(16)19/h4-9,13H,10H2,1-3H3.
What are the key properties of 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one?
4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one has a molecular weight of 250.34 g/mol, XLogP of 4.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylphenyl)-2-methyl-2,3-dihydroinden-1-one is sourced from PubChem (CID 22173236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).