About 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one
2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one (PubChem CID 22173335) has the molecular formula C17H16O
and a molecular weight of 236.31 g/mol. Its IUPAC name is 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one |
| PubChem CID | 22173335 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one |
| SMILES | Cc1ccc2c(c1-c1ccccc1)C(=O)C(C)C2 |
| InChI | InChI=1S/C17H16O/c1-11-8-9-14-10-12(2)17(18)16(14)15(11)13-6-4-3-5-7-13/h3-9,12H,10H2,1-2H3 |
| InChIKey | APPGBWSUAREXNV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one?
The IUPAC name of 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one (CID 22173335) is 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one.
What is the SMILES notation for 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one?
The canonical SMILES for 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one is Cc1ccc2c(c1-c1ccccc1)C(=O)C(C)C2.
What is the InChIKey of 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one?
The InChIKey is APPGBWSUAREXNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O/c1-11-8-9-14-10-12(2)17(18)16(14)15(11)13-6-4-3-5-7-13/h3-9,12H,10H2,1-2H3.
What are the key properties of 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one?
2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one has a molecular weight of 236.31 g/mol, XLogP of 4.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-7-phenyl-2,3-dihydroinden-1-one is sourced from PubChem (CID 22173335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).