About ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate
ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate (PubChem CID 22173381) has the molecular formula C13H14O4
and a molecular weight of 234.25 g/mol. Its IUPAC name is ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate.
Molecular Properties
| Compound Name | ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate |
| PubChem CID | 22173381 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate |
| SMILES | CCOC(=O)Oc1cccc2c1C(=O)C(C)C2 |
| InChI | InChI=1S/C13H14O4/c1-3-16-13(15)17-10-6-4-5-9-7-8(2)12(14)11(9)10/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | YFQQWUHGQJKBJD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate?
The IUPAC name of ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate (CID 22173381) is ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate.
What is the SMILES notation for ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate?
The canonical SMILES for ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate is CCOC(=O)Oc1cccc2c1C(=O)C(C)C2.
What is the InChIKey of ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate?
The InChIKey is YFQQWUHGQJKBJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O4/c1-3-16-13(15)17-10-6-4-5-9-7-8(2)12(14)11(9)10/h4-6,8H,3,7H2,1-2H3.
What are the key properties of ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate?
ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate has a molecular weight of 234.25 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2-methyl-3-oxo-1,2-dihydroinden-4-yl) carbonate is sourced from PubChem (CID 22173381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).