About methyl 2-methylprop-2-enoate;methyl prop-2-enoate
methyl 2-methylprop-2-enoate;methyl prop-2-enoate (PubChem CID 22173653) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;methyl prop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-methylprop-2-enoate;methyl prop-2-enoate |
| PubChem CID | 22173653 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | methyl 2-methylprop-2-enoate;methyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)OC |
| InChI | InChI=1S/C5H8O2.C4H6O2/c1-4(2)5(6)7-3;1-3-4(5)6-2/h1H2,2-3H3;3H,1H2,2H3 |
| InChIKey | NXMXPVQZFYYPGD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylprop-2-enoate;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylprop-2-enoate;methyl prop-2-enoate?
The IUPAC name of methyl 2-methylprop-2-enoate;methyl prop-2-enoate (CID 22173653) is methyl 2-methylprop-2-enoate;methyl prop-2-enoate.
What is the SMILES notation for methyl 2-methylprop-2-enoate;methyl prop-2-enoate?
The canonical SMILES for methyl 2-methylprop-2-enoate;methyl prop-2-enoate is C=C(C)C(=O)OC.C=CC(=O)OC.
What is the InChIKey of methyl 2-methylprop-2-enoate;methyl prop-2-enoate?
The InChIKey is NXMXPVQZFYYPGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H6O2/c1-4(2)5(6)7-3;1-3-4(5)6-2/h1H2,2-3H3;3H,1H2,2H3.
What are the key properties of methyl 2-methylprop-2-enoate;methyl prop-2-enoate?
methyl 2-methylprop-2-enoate;methyl prop-2-enoate has a molecular weight of 186.21 g/mol, XLogP of 1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylprop-2-enoate;methyl prop-2-enoate is sourced from PubChem (CID 22173653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).