C9H7F11 — CID 22173776
1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-propan-2-ylcyclohexane (PubChem CID 22173776) has the molecular formula C9H7F11 and a molecular weight of 324.13 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-propan-2-ylcyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 22173776 |
| Molecular Formula | C9H7F11 |
| Molecular Weight | 324.13 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-propan-2-ylcyclohexane |
| SMILES | CC(C)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H7F11/c1-3(2)4(10)5(11,12)7(15,16)9(19,20)8(17,18)6(4,13)14/h3H,1-2H3 |
| InChIKey | QTSLLLOCJZMSKN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.13 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|