About 3-amino-2-(3,5-dimethoxyphenyl)phenol
3-amino-2-(3,5-dimethoxyphenyl)phenol (PubChem CID 22173860) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-amino-2-(3,5-dimethoxyphenyl)phenol.
Molecular Properties
| Compound Name | 3-amino-2-(3,5-dimethoxyphenyl)phenol |
| PubChem CID | 22173860 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-amino-2-(3,5-dimethoxyphenyl)phenol |
| SMILES | COc1cc(OC)cc(-c2c(N)cccc2O)c1 |
| InChI | InChI=1S/C14H15NO3/c1-17-10-6-9(7-11(8-10)18-2)14-12(15)4-3-5-13(14)16/h3-8,16H,15H2,1-2H3 |
| InChIKey | SVCLCEPBRGJSNB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-(3,5-dimethoxyphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(3,5-dimethoxyphenyl)phenol?
The IUPAC name of 3-amino-2-(3,5-dimethoxyphenyl)phenol (CID 22173860) is 3-amino-2-(3,5-dimethoxyphenyl)phenol.
What is the SMILES notation for 3-amino-2-(3,5-dimethoxyphenyl)phenol?
The canonical SMILES for 3-amino-2-(3,5-dimethoxyphenyl)phenol is COc1cc(OC)cc(-c2c(N)cccc2O)c1.
What is the InChIKey of 3-amino-2-(3,5-dimethoxyphenyl)phenol?
The InChIKey is SVCLCEPBRGJSNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3/c1-17-10-6-9(7-11(8-10)18-2)14-12(15)4-3-5-13(14)16/h3-8,16H,15H2,1-2H3.
What are the key properties of 3-amino-2-(3,5-dimethoxyphenyl)phenol?
3-amino-2-(3,5-dimethoxyphenyl)phenol has a molecular weight of 245.28 g/mol, XLogP of 2.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(3,5-dimethoxyphenyl)phenol is sourced from PubChem (CID 22173860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).