About butane-1,2,4-tricarbaldehyde
butane-1,2,4-tricarbaldehyde (PubChem CID 22174207) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is butane-1,2,4-tricarbaldehyde.
Molecular Properties
| Compound Name | butane-1,2,4-tricarbaldehyde |
| PubChem CID | 22174207 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | butane-1,2,4-tricarbaldehyde |
| SMILES | O=CCCC(C=O)CC=O |
| InChI | InChI=1S/C7H10O3/c8-4-1-2-7(6-10)3-5-9/h4-7H,1-3H2 |
| InChIKey | BWBDIVJHFOSTOD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze butane-1,2,4-tricarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,2,4-tricarbaldehyde?
The IUPAC name of butane-1,2,4-tricarbaldehyde (CID 22174207) is butane-1,2,4-tricarbaldehyde.
What is the SMILES notation for butane-1,2,4-tricarbaldehyde?
The canonical SMILES for butane-1,2,4-tricarbaldehyde is O=CCCC(C=O)CC=O.
What is the InChIKey of butane-1,2,4-tricarbaldehyde?
The InChIKey is BWBDIVJHFOSTOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c8-4-1-2-7(6-10)3-5-9/h4-7H,1-3H2.
What are the key properties of butane-1,2,4-tricarbaldehyde?
butane-1,2,4-tricarbaldehyde has a molecular weight of 142.15 g/mol, XLogP of 0.37, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,2,4-tricarbaldehyde is sourced from PubChem (CID 22174207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).