About ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol
ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 22174281) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol.
Molecular Properties
| Compound Name | ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
| PubChem CID | 22174281 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | C=C.C=COC=C.CCC(CO)(CO)CO |
| InChI | InChI=1S/C6H14O3.C4H6O.C2H4/c1-2-6(3-7,4-8)5-9;1-3-5-4-2;1-2/h7-9H,2-5H2,1H3;3-4H,1-2H2;1-2H2 |
| InChIKey | UZUVUQTZSXOKKY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol?
The IUPAC name of ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol (CID 22174281) is ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol.
What is the SMILES notation for ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol?
The canonical SMILES for ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol is C=C.C=COC=C.CCC(CO)(CO)CO.
What is the InChIKey of ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol?
The InChIKey is UZUVUQTZSXOKKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3.C4H6O.C2H4/c1-2-6(3-7,4-8)5-9;1-3-5-4-2;1-2/h7-9H,2-5H2,1H3;3-4H,1-2H2;1-2H2.
What are the key properties of ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol?
ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol has a molecular weight of 232.32 g/mol, XLogP of 1.45, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;ethenoxyethene;2-ethyl-2-(hydroxymethyl)propane-1,3-diol is sourced from PubChem (CID 22174281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).