About ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium
ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium (PubChem CID 22174412) has the molecular formula C7H18N2O6P2
and a molecular weight of 288.18 g/mol. Its IUPAC name is ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium.
Molecular Properties
| Compound Name | ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium |
| PubChem CID | 22174412 |
| Molecular Formula | C7H18N2O6P2 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium |
| SMILES | NCCN.O=[P+]([O-])OCCCCCO[P+](=O)[O-] |
| InChI | InChI=1S/C5H10O6P2.C2H8N2/c6-12(7)10-4-2-1-3-5-11-13(8)9;3-1-2-4/h1-5H2;1-4H2 |
| InChIKey | QZNNNEPXTWALKV-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 150.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium?
The IUPAC name of ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium (CID 22174412) is ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium.
What is the SMILES notation for ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium?
The canonical SMILES for ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium is NCCN.O=[P+]([O-])OCCCCCO[P+](=O)[O-].
What is the InChIKey of ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium?
The InChIKey is QZNNNEPXTWALKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O6P2.C2H8N2/c6-12(7)10-4-2-1-3-5-11-13(8)9;3-1-2-4/h1-5H2;1-4H2.
What are the key properties of ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium?
ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium has a molecular weight of 288.18 g/mol, XLogP of -0.87, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diamine;oxido-oxo-(5-phosphooxypentoxy)phosphanium is sourced from PubChem (CID 22174412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).