C8H18ClN5 — CID 22174774
2-N,2-N,6-N,6-N,4-pentamethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride (PubChem CID 22174774) has the molecular formula C8H18ClN5 and a molecular weight of 219.72 g/mol. Its IUPAC name is 2-N,2-N,6-N,6-N,4-pentamethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride.
| Compound Name | 2-N,2-N,6-N,6-N,4-pentamethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 22174774 |
| Molecular Formula | C8H18ClN5 |
| Molecular Weight | 219.72 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-N,2-N,6-N,6-N,4-pentamethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine;hydrochloride |
| SMILES | CC1N=C(N(C)C)NC(N(C)C)=N1.Cl |
| InChI | InChI=1S/C8H17N5.ClH/c1-6-9-7(12(2)3)11-8(10-6)13(4)5;/h6H,1-5H3,(H,9,10,11);1H |
| InChIKey | XYDLIZKNTRKHRO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.72 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |