About 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid
4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid (PubChem CID 22175237) has the molecular formula C18H21Cl2NO4
and a molecular weight of 386.28 g/mol. Its IUPAC name is 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid |
| PubChem CID | 22175237 |
| Molecular Formula | C18H21Cl2NO4 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid |
| SMILES | CCCCOc1c(C(=O)O)n(CC(C)C)c(=O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C18H21Cl2NO4/c1-4-5-6-25-16-11-7-13(19)14(20)8-12(11)17(22)21(9-10(2)3)15(16)18(23)24/h7-8,10H,4-6,9H2,1-3H3,(H,23,24) |
| InChIKey | AQCWBCGNUMFIHH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid?
The IUPAC name of 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid (CID 22175237) is 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid.
What is the SMILES notation for 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid?
The canonical SMILES for 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid is CCCCOc1c(C(=O)O)n(CC(C)C)c(=O)c2cc(Cl)c(Cl)cc12.
What is the InChIKey of 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid?
The InChIKey is AQCWBCGNUMFIHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21Cl2NO4/c1-4-5-6-25-16-11-7-13(19)14(20)8-12(11)17(22)21(9-10(2)3)15(16)18(23)24/h7-8,10H,4-6,9H2,1-3H3,(H,23,24).
What are the key properties of 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid?
4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid has a molecular weight of 386.28 g/mol, XLogP of 4.84, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-6,7-dichloro-2-(2-methylpropyl)-1-oxoisoquinoline-3-carboxylic acid is sourced from PubChem (CID 22175237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).