About 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one
4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one (PubChem CID 22175253) has the molecular formula C17H20Cl3NO2
and a molecular weight of 376.71 g/mol. Its IUPAC name is 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one.
Molecular Properties
| Compound Name | 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one |
| PubChem CID | 22175253 |
| Molecular Formula | C17H20Cl3NO2 |
| Molecular Weight | 376.71 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one |
| SMILES | CCCCOc1c(CCl)n(C(C)C)c(=O)c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C17H20Cl3NO2/c1-4-5-6-23-16-11-7-13(19)14(20)8-12(11)17(22)21(10(2)3)15(16)9-18/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | FNOPLEZFENSGIK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.71 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one?
The IUPAC name of 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one (CID 22175253) is 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one.
What is the SMILES notation for 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one?
The canonical SMILES for 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one is CCCCOc1c(CCl)n(C(C)C)c(=O)c2cc(Cl)c(Cl)cc12.
What is the InChIKey of 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one?
The InChIKey is FNOPLEZFENSGIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20Cl3NO2/c1-4-5-6-23-16-11-7-13(19)14(20)8-12(11)17(22)21(10(2)3)15(16)9-18/h7-8,10H,4-6,9H2,1-3H3.
What are the key properties of 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one?
4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one has a molecular weight of 376.71 g/mol, XLogP of 5.81, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-6,7-dichloro-3-(chloromethyl)-2-propan-2-ylisoquinolin-1-one is sourced from PubChem (CID 22175253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).