C27H29FN2O4 — CID 22175297
2-[[4-butoxy-2-(2,2-dimethylpropyl)-6-fluoro-1-oxoisoquinolin-3-yl]methyl]isoindole-1,3-dione (PubChem CID 22175297) has the molecular formula C27H29FN2O4 and a molecular weight of 464.54 g/mol. Its IUPAC name is 2-[[4-butoxy-2-(2,2-dimethylpropyl)-6-fluoro-1-oxoisoquinolin-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-butoxy-2-(2,2-dimethylpropyl)-6-fluoro-1-oxoisoquinolin-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22175297 |
| Molecular Formula | C27H29FN2O4 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-[[4-butoxy-2-(2,2-dimethylpropyl)-6-fluoro-1-oxoisoquinolin-3-yl]methyl]isoindole-1,3-dione |
| SMILES | CCCCOc1c(CN2C(=O)c3ccccc3C2=O)n(CC(C)(C)C)c(=O)c2ccc(F)cc12 |
| InChI | InChI=1S/C27H29FN2O4/c1-5-6-13-34-23-21-14-17(28)11-12-20(21)26(33)30(16-27(2,3)4)22(23)15-29-24(31)18-9-7-8-10-19(18)25(29)32/h7-12,14H,5-6,13,15-16H2,1-4H3 |
| InChIKey | MQQHJQIPWHIKCG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|