C24H31ClN2O2 — CID 22176080
3-(aminomethyl)-4-butoxy-2-(2-methylpropyl)-6-phenylisoquinolin-1-one;hydrochloride (PubChem CID 22176080) has the molecular formula C24H31ClN2O2 and a molecular weight of 414.98 g/mol. Its IUPAC name is 3-(aminomethyl)-4-butoxy-2-(2-methylpropyl)-6-phenylisoquinolin-1-one;hydrochloride.
| Compound Name | 3-(aminomethyl)-4-butoxy-2-(2-methylpropyl)-6-phenylisoquinolin-1-one;hydrochloride |
|---|---|
| PubChem CID | 22176080 |
| Molecular Formula | C24H31ClN2O2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 3-(aminomethyl)-4-butoxy-2-(2-methylpropyl)-6-phenylisoquinolin-1-one;hydrochloride |
| SMILES | CCCCOc1c(CN)n(CC(C)C)c(=O)c2ccc(-c3ccccc3)cc12.Cl |
| InChI | InChI=1S/C24H30N2O2.ClH/c1-4-5-13-28-23-21-14-19(18-9-7-6-8-10-18)11-12-20(21)24(27)26(16-17(2)3)22(23)15-25;/h6-12,14,17H,4-5,13,15-16,25H2,1-3H3;1H |
| InChIKey | QJDKUSPGYTUIID-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|