About 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride
3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride (PubChem CID 22176334) has the molecular formula C21H27Cl2N3O
and a molecular weight of 408.37 g/mol. Its IUPAC name is 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride.
Molecular Properties
| Compound Name | 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride |
| PubChem CID | 22176334 |
| Molecular Formula | C21H27Cl2N3O |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride |
| SMILES | CC(C)Cn1c(CN)c(-c2ccccc2)c2cc(CN)ccc2c1=O.Cl.Cl |
| InChI | InChI=1S/C21H25N3O.2ClH/c1-14(2)13-24-19(12-23)20(16-6-4-3-5-7-16)18-10-15(11-22)8-9-17(18)21(24)25;;/h3-10,14H,11-13,22-23H2,1-2H3;2*1H |
| InChIKey | ODTBLITYPQIBDZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride?
The IUPAC name of 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride (CID 22176334) is 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride.
What is the SMILES notation for 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride?
The canonical SMILES for 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride is CC(C)Cn1c(CN)c(-c2ccccc2)c2cc(CN)ccc2c1=O.Cl.Cl.
What is the InChIKey of 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride?
The InChIKey is ODTBLITYPQIBDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O.2ClH/c1-14(2)13-24-19(12-23)20(16-6-4-3-5-7-16)18-10-15(11-22)8-9-17(18)21(24)25;;/h3-10,14H,11-13,22-23H2,1-2H3;2*1H.
What are the key properties of 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride?
3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride has a molecular weight of 408.37 g/mol, XLogP of 4.09, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis(aminomethyl)-2-(2-methylpropyl)-4-phenylisoquinolin-1-one;dihydrochloride is sourced from PubChem (CID 22176334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).