C18H20ClN3O — CID 22176751
1-(4-chlorophenyl)-N-(5-cyclopropyl-1H-pyrazol-3-yl)cyclopentane-1-carboxamide (PubChem CID 22176751) has the molecular formula C18H20ClN3O and a molecular weight of 329.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(5-cyclopropyl-1H-pyrazol-3-yl)cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(5-cyclopropyl-1H-pyrazol-3-yl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 22176751 |
| Molecular Formula | C18H20ClN3O |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(5-cyclopropyl-1H-pyrazol-3-yl)cyclopentane-1-carboxamide |
| SMILES | O=C(Nc1cc(C2CC2)[nH]n1)C1(c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C18H20ClN3O/c19-14-7-5-13(6-8-14)18(9-1-2-10-18)17(23)20-16-11-15(21-22-16)12-3-4-12/h5-8,11-12H,1-4,9-10H2,(H2,20,21,22,23) |
| InChIKey | IUQZEGBBRAMGIZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |