About 2-methyl-N,N-dioctylprop-2-enamide
2-methyl-N,N-dioctylprop-2-enamide (PubChem CID 22177298) has the molecular formula C20H39NO
and a molecular weight of 309.54 g/mol. Its IUPAC name is 2-methyl-N,N-dioctylprop-2-enamide.
Molecular Properties
| Compound Name | 2-methyl-N,N-dioctylprop-2-enamide |
| PubChem CID | 22177298 |
| Molecular Formula | C20H39NO |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.30 |
| IUPAC Name | 2-methyl-N,N-dioctylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C20H39NO/c1-5-7-9-11-13-15-17-21(20(22)19(3)4)18-16-14-12-10-8-6-2/h3,5-18H2,1-2,4H3 |
| InChIKey | ZJUCEZKOOKQHKH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N,N-dioctylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,N-dioctylprop-2-enamide?
The IUPAC name of 2-methyl-N,N-dioctylprop-2-enamide (CID 22177298) is 2-methyl-N,N-dioctylprop-2-enamide.
What is the SMILES notation for 2-methyl-N,N-dioctylprop-2-enamide?
The canonical SMILES for 2-methyl-N,N-dioctylprop-2-enamide is C=C(C)C(=O)N(CCCCCCCC)CCCCCCCC.
What is the InChIKey of 2-methyl-N,N-dioctylprop-2-enamide?
The InChIKey is ZJUCEZKOOKQHKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39NO/c1-5-7-9-11-13-15-17-21(20(22)19(3)4)18-16-14-12-10-8-6-2/h3,5-18H2,1-2,4H3.
What are the key properties of 2-methyl-N,N-dioctylprop-2-enamide?
2-methyl-N,N-dioctylprop-2-enamide has a molecular weight of 309.54 g/mol, XLogP of 6.11, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,N-dioctylprop-2-enamide is sourced from PubChem (CID 22177298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).