About CID 22177376
CID 22177376 (PubChem CID 22177376) has the molecular formula C14H25OSi
and a molecular weight of 237.44 g/mol.
Molecular Properties
| Compound Name | CID 22177376 |
| PubChem CID | 22177376 |
| Molecular Formula | C14H25OSi |
| Molecular Weight | 237.44 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | — |
| SMILES | C/C1=C(\O[Si])CCCCCC1(C)C(C)(C)C |
| InChI | InChI=1S/C14H25OSi/c1-11-12(15-16)9-7-6-8-10-14(11,5)13(2,3)4/h6-10H2,1-5H3/b12-11+ |
| InChIKey | NNZLCGBZJIVJQJ-VAWYXSNFSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22177376 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22177376?
The IUPAC name of CID 22177376 (CID 22177376) is not available.
What is the SMILES notation for CID 22177376?
The canonical SMILES for CID 22177376 is C/C1=C(\O[Si])CCCCCC1(C)C(C)(C)C.
What is the InChIKey of CID 22177376?
The InChIKey is NNZLCGBZJIVJQJ-VAWYXSNFSA-N. The full InChI is InChI=1S/C14H25OSi/c1-11-12(15-16)9-7-6-8-10-14(11,5)13(2,3)4/h6-10H2,1-5H3/b12-11+.
What are the key properties of CID 22177376?
CID 22177376 has a molecular weight of 237.44 g/mol, XLogP of 4.38, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22177376 is sourced from PubChem (CID 22177376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).