C23H30N4 — CID 22177795
10-(2,5-dimethylphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 22177795) has the molecular formula C23H30N4 and a molecular weight of 362.52 g/mol. Its IUPAC name is 10-(2,5-dimethylphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 10-(2,5-dimethylphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 22177795 |
| Molecular Formula | C23H30N4 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 10-(2,5-dimethylphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4cc(C)ccc4C)c(C)nn13)CCC2 |
| InChI | InChI=1S/C23H30N4/c1-6-17(7-2)24-22-18-9-8-10-20(18)25-23-21(16(5)26-27(22)23)19-13-14(3)11-12-15(19)4/h11-13,17,24H,6-10H2,1-5H3 |
| InChIKey | CTHDZVRRKZJPEN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |