C22H26ClN5O — CID 22177814
3-chloro-4-[11-methyl-2-(pentan-3-ylamino)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-10-yl]benzamide (PubChem CID 22177814) has the molecular formula C22H26ClN5O and a molecular weight of 411.94 g/mol. Its IUPAC name is 3-chloro-4-[11-methyl-2-(pentan-3-ylamino)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-10-yl]benzamide.
| Compound Name | 3-chloro-4-[11-methyl-2-(pentan-3-ylamino)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-10-yl]benzamide |
|---|---|
| PubChem CID | 22177814 |
| Molecular Formula | C22H26ClN5O |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-chloro-4-[11-methyl-2-(pentan-3-ylamino)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-10-yl]benzamide |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4ccc(C(N)=O)cc4Cl)c(C)nn13)CCC2 |
| InChI | InChI=1S/C22H26ClN5O/c1-4-14(5-2)25-21-16-7-6-8-18(16)26-22-19(12(3)27-28(21)22)15-10-9-13(20(24)29)11-17(15)23/h9-11,14,25H,4-8H2,1-3H3,(H2,24,29) |
| InChIKey | PIYCBURWHBOQKW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |