C22H28N4O2 — CID 22177839
10-(4-methoxy-2-methylphenyl)-11-methyl-N-pentan-3-yl-4-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 22177839) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 10-(4-methoxy-2-methylphenyl)-11-methyl-N-pentan-3-yl-4-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 10-(4-methoxy-2-methylphenyl)-11-methyl-N-pentan-3-yl-4-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 22177839 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 10-(4-methoxy-2-methylphenyl)-11-methyl-N-pentan-3-yl-4-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4ccc(OC)cc4C)c(C)nn13)CCO2 |
| InChI | InChI=1S/C22H28N4O2/c1-6-15(7-2)23-22-20-18(10-11-28-20)24-21-19(14(4)25-26(21)22)17-9-8-16(27-5)12-13(17)3/h8-9,12,15,23H,6-7,10-11H2,1-5H3 |
| InChIKey | TUGHBCXQTCPDTB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |