C23H31ClN4O — CID 22177932
10-(2-methoxy-4,6-dimethylphenyl)-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride (PubChem CID 22177932) has the molecular formula C23H31ClN4O and a molecular weight of 414.98 g/mol. Its IUPAC name is 10-(2-methoxy-4,6-dimethylphenyl)-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride.
| Compound Name | 10-(2-methoxy-4,6-dimethylphenyl)-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 22177932 |
| Molecular Formula | C23H31ClN4O |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 10-(2-methoxy-4,6-dimethylphenyl)-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4c(C)cc(C)cc4OC)cnn13)CCC2.Cl |
| InChI | InChI=1S/C23H30N4O.ClH/c1-6-16(7-2)25-22-17-9-8-10-19(17)26-23-18(13-24-27(22)23)21-15(4)11-14(3)12-20(21)28-5;/h11-13,16,25H,6-10H2,1-5H3;1H |
| InChIKey | LZLDXBAJBOALFN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |