C22H29ClN4O — CID 22177987
10-(4-methoxy-2-methylphenyl)-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride (PubChem CID 22177987) has the molecular formula C22H29ClN4O and a molecular weight of 400.95 g/mol. Its IUPAC name is 10-(4-methoxy-2-methylphenyl)-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride.
| Compound Name | 10-(4-methoxy-2-methylphenyl)-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 22177987 |
| Molecular Formula | C22H29ClN4O |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 10-(4-methoxy-2-methylphenyl)-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4ccc(OC)cc4C)cnn13)CCC2.Cl |
| InChI | InChI=1S/C22H28N4O.ClH/c1-5-15(6-2)24-21-18-8-7-9-20(18)25-22-19(13-23-26(21)22)17-11-10-16(27-4)12-14(17)3;/h10-13,15,24H,5-9H2,1-4H3;1H |
| InChIKey | NURNQFRQWDJQGY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |