C23H30Cl2N4O — CID 22178018
10-(2-chloro-4-ethoxyphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride (PubChem CID 22178018) has the molecular formula C23H30Cl2N4O and a molecular weight of 449.43 g/mol. Its IUPAC name is 10-(2-chloro-4-ethoxyphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride.
| Compound Name | 10-(2-chloro-4-ethoxyphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 22178018 |
| Molecular Formula | C23H30Cl2N4O |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 10-(2-chloro-4-ethoxyphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
| SMILES | CCOc1ccc(-c2c(C)nn3c(NC(CC)CC)c4c(nc23)CCC4)c(Cl)c1.Cl |
| InChI | InChI=1S/C23H29ClN4O.ClH/c1-5-15(6-2)25-22-18-9-8-10-20(18)26-23-21(14(4)27-28(22)23)17-12-11-16(29-7-3)13-19(17)24;/h11-13,15,25H,5-10H2,1-4H3;1H |
| InChIKey | UZARYAHMVOKPDE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |