C27H29ClN4O — CID 22178060
10-(2-chloro-4-methoxyphenyl)-N-[(4-methylphenyl)methyl]-N-propyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 22178060) has the molecular formula C27H29ClN4O and a molecular weight of 461.01 g/mol. Its IUPAC name is 10-(2-chloro-4-methoxyphenyl)-N-[(4-methylphenyl)methyl]-N-propyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 10-(2-chloro-4-methoxyphenyl)-N-[(4-methylphenyl)methyl]-N-propyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 22178060 |
| Molecular Formula | C27H29ClN4O |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 10-(2-chloro-4-methoxyphenyl)-N-[(4-methylphenyl)methyl]-N-propyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCCN(Cc1ccc(C)cc1)c1c2c(nc3c(-c4ccc(OC)cc4Cl)cnn13)CCC2 |
| InChI | InChI=1S/C27H29ClN4O/c1-4-14-31(17-19-10-8-18(2)9-11-19)27-22-6-5-7-25(22)30-26-23(16-29-32(26)27)21-13-12-20(33-3)15-24(21)28/h8-13,15-16H,4-7,14,17H2,1-3H3 |
| InChIKey | AUBTYMSRPCUPQF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |