C26H27ClN4O2 — CID 22178062
10-(2-chloro-4-methoxyphenyl)-N-[(4-methylphenyl)methyl]-N-propyl-5-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 22178062) has the molecular formula C26H27ClN4O2 and a molecular weight of 462.98 g/mol. Its IUPAC name is 10-(2-chloro-4-methoxyphenyl)-N-[(4-methylphenyl)methyl]-N-propyl-5-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 10-(2-chloro-4-methoxyphenyl)-N-[(4-methylphenyl)methyl]-N-propyl-5-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 22178062 |
| Molecular Formula | C26H27ClN4O2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 10-(2-chloro-4-methoxyphenyl)-N-[(4-methylphenyl)methyl]-N-propyl-5-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCCN(Cc1ccc(C)cc1)c1c2c(nc3c(-c4ccc(OC)cc4Cl)cnn13)COC2 |
| InChI | InChI=1S/C26H27ClN4O2/c1-4-11-30(14-18-7-5-17(2)6-8-18)26-22-15-33-16-24(22)29-25-21(13-28-31(25)26)20-10-9-19(32-3)12-23(20)27/h5-10,12-13H,4,11,14-16H2,1-3H3 |
| InChIKey | NPPSUJSKOYABDX-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 51.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |