C22H28Cl2N4O2 — CID 22178098
10-(2-chloro-4-ethoxyphenyl)-11-methyl-N-pentan-3-yl-5-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride (PubChem CID 22178098) has the molecular formula C22H28Cl2N4O2 and a molecular weight of 451.40 g/mol. Its IUPAC name is 10-(2-chloro-4-ethoxyphenyl)-11-methyl-N-pentan-3-yl-5-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride.
| Compound Name | 10-(2-chloro-4-ethoxyphenyl)-11-methyl-N-pentan-3-yl-5-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 22178098 |
| Molecular Formula | C22H28Cl2N4O2 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 10-(2-chloro-4-ethoxyphenyl)-11-methyl-N-pentan-3-yl-5-oxa-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
| SMILES | CCOc1ccc(-c2c(C)nn3c(NC(CC)CC)c4c(nc23)COC4)c(Cl)c1.Cl |
| InChI | InChI=1S/C22H27ClN4O2.ClH/c1-5-14(6-2)24-21-17-11-28-12-19(17)25-22-20(13(4)26-27(21)22)16-9-8-15(29-7-3)10-18(16)23;/h8-10,14,24H,5-7,11-12H2,1-4H3;1H |
| InChIKey | FHWZVYNMFSZGDC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |