C25H26ClN3O2 — CID 22178152
10-(4-methoxy-2-methylphenyl)-2-(4-methoxyphenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene;hydrochloride (PubChem CID 22178152) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 10-(4-methoxy-2-methylphenyl)-2-(4-methoxyphenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene;hydrochloride.
| Compound Name | 10-(4-methoxy-2-methylphenyl)-2-(4-methoxyphenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene;hydrochloride |
|---|---|
| PubChem CID | 22178152 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 10-(4-methoxy-2-methylphenyl)-2-(4-methoxyphenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene;hydrochloride |
| SMILES | COc1ccc(-c2c3c(nc4c(-c5ccc(OC)cc5C)c(C)nn24)CCC3)cc1.Cl |
| InChI | InChI=1S/C25H25N3O2.ClH/c1-15-14-19(30-4)12-13-20(15)23-16(2)27-28-24(17-8-10-18(29-3)11-9-17)21-6-5-7-22(21)26-25(23)28;/h8-14H,5-7H2,1-4H3;1H |
| InChIKey | GDMWBSLPPVWKJQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |