About 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal
3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal (PubChem CID 22178202) has the molecular formula C19H42O3Si2
and a molecular weight of 374.71 g/mol. Its IUPAC name is 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal.
Molecular Properties
| Compound Name | 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal |
| PubChem CID | 22178202 |
| Molecular Formula | C19H42O3Si2 |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal |
| SMILES | CC(C)(C=O)C(CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H42O3Si2/c1-17(2,3)23(9,10)21-14-13-16(19(7,8)15-20)22-24(11,12)18(4,5)6/h15-16H,13-14H2,1-12H3 |
| InChIKey | JGCPIQIDIBNWDL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal?
The IUPAC name of 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal (CID 22178202) is 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal.
What is the SMILES notation for 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal?
The canonical SMILES for 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal is CC(C)(C=O)C(CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal?
The InChIKey is JGCPIQIDIBNWDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H42O3Si2/c1-17(2,3)23(9,10)21-14-13-16(19(7,8)15-20)22-24(11,12)18(4,5)6/h15-16H,13-14H2,1-12H3.
What are the key properties of 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal?
3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal has a molecular weight of 374.71 g/mol, XLogP of 6.01, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethylpentanal is sourced from PubChem (CID 22178202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).