C10H2Cl6O2 — CID 22178257
3,4,5,6,7,8-hexachloronaphthalene-1,2-diol (PubChem CID 22178257) has the molecular formula C10H2Cl6O2 and a molecular weight of 366.84 g/mol. Its IUPAC name is 3,4,5,6,7,8-hexachloronaphthalene-1,2-diol.
| Compound Name | 3,4,5,6,7,8-hexachloronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 22178257 |
| Molecular Formula | C10H2Cl6O2 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 363.82 |
| IUPAC Name | 3,4,5,6,7,8-hexachloronaphthalene-1,2-diol |
| SMILES | Oc1c(Cl)c(Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2c1O |
| InChI | InChI=1S/C10H2Cl6O2/c11-3-1-2(5(13)7(15)6(3)14)9(17)10(18)8(16)4(1)12/h17-18H |
| InChIKey | PMEGCSRBYZNSFL-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|