C12H3F7O2 — CID 22178275
2,3,5,6-tetrafluoro-4-(2,3,5-trifluoro-4-hydroxyphenyl)phenol (PubChem CID 22178275) has the molecular formula C12H3F7O2 and a molecular weight of 312.14 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,3,5-trifluoro-4-hydroxyphenyl)phenol.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,3,5-trifluoro-4-hydroxyphenyl)phenol |
|---|---|
| PubChem CID | 22178275 |
| Molecular Formula | C12H3F7O2 |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,3,5-trifluoro-4-hydroxyphenyl)phenol |
| SMILES | Oc1c(F)cc(-c2c(F)c(F)c(O)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12H3F7O2/c13-3-1-2(5(14)8(17)11(3)20)4-6(15)9(18)12(21)10(19)7(4)16/h1,20-21H |
| InChIKey | UHGRVYDBBDCHNT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|