C14H4F6O2 — CID 22178333
3,4,5,6,7,8-hexafluoroanthracene-1,2-diol (PubChem CID 22178333) has the molecular formula C14H4F6O2 and a molecular weight of 318.17 g/mol. Its IUPAC name is 3,4,5,6,7,8-hexafluoroanthracene-1,2-diol.
| Compound Name | 3,4,5,6,7,8-hexafluoroanthracene-1,2-diol |
|---|---|
| PubChem CID | 22178333 |
| Molecular Formula | C14H4F6O2 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 3,4,5,6,7,8-hexafluoroanthracene-1,2-diol |
| SMILES | Oc1c(F)c(F)c2cc3c(F)c(F)c(F)c(F)c3cc2c1O |
| InChI | InChI=1S/C14H4F6O2/c15-7-3-1-5-6(13(21)14(22)12(20)9(5)17)2-4(3)8(16)11(19)10(7)18/h1-2,21-22H |
| InChIKey | YABYDCKEQHVEFE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|