C22H29F3N6O7S — CID 22178583
3-(diaminomethylideneamino)oxy-2-[6-methyl-2-oxo-3-[(2,4,6-trimethylphenyl)sulfonylamino]-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid (PubChem CID 22178583) has the molecular formula C22H29F3N6O7S and a molecular weight of 578.57 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)oxy-2-[6-methyl-2-oxo-3-[(2,4,6-trimethylphenyl)sulfonylamino]-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(diaminomethylideneamino)oxy-2-[6-methyl-2-oxo-3-[(2,4,6-trimethylphenyl)sulfonylamino]-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22178583 |
| Molecular Formula | C22H29F3N6O7S |
| Molecular Weight | 578.57 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | 3-(diaminomethylideneamino)oxy-2-[6-methyl-2-oxo-3-[(2,4,6-trimethylphenyl)sulfonylamino]-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc(C)n(C(C(N)=O)C(C)ON=C(N)N)c2=O)c(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N6O5S.C2HF3O2/c1-10-8-11(2)17(12(3)9-10)32(29,30)25-15-7-6-13(4)26(19(15)28)16(18(21)27)14(5)31-24-20(22)23;3-2(4,5)1(6)7/h6-9,14,16,25H,1-5H3,(H2,21,27)(H4,22,23,24);(H,6,7) |
| InChIKey | DIWVRWGBPXVNEN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 222.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.57 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|