C21H25F3N6O7S — CID 22178585
3-(diaminomethylideneamino)oxy-2-[3-[(4-ethenylphenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid (PubChem CID 22178585) has the molecular formula C21H25F3N6O7S and a molecular weight of 562.53 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)oxy-2-[3-[(4-ethenylphenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(diaminomethylideneamino)oxy-2-[3-[(4-ethenylphenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22178585 |
| Molecular Formula | C21H25F3N6O7S |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 3-(diaminomethylideneamino)oxy-2-[3-[(4-ethenylphenyl)sulfonylamino]-6-methyl-2-oxo-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid |
| SMILES | C=Cc1ccc(S(=O)(=O)Nc2ccc(C)n(C(C(N)=O)C(C)ON=C(N)N)c2=O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24N6O5S.C2HF3O2/c1-4-13-6-8-14(9-7-13)31(28,29)24-15-10-5-11(2)25(18(15)27)16(17(20)26)12(3)30-23-19(21)22;3-2(4,5)1(6)7/h4-10,12,16,24H,1H2,2-3H3,(H2,20,26)(H4,21,22,23);(H,6,7) |
| InChIKey | IDAVMPBZHUHKFB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 222.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|