C21H27F3N6O7S — CID 22178591
3-(diaminomethylideneamino)oxy-N-methyl-2-[6-methyl-3-[(3-methylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid (PubChem CID 22178591) has the molecular formula C21H27F3N6O7S and a molecular weight of 564.54 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)oxy-N-methyl-2-[6-methyl-3-[(3-methylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(diaminomethylideneamino)oxy-N-methyl-2-[6-methyl-3-[(3-methylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22178591 |
| Molecular Formula | C21H27F3N6O7S |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | 3-(diaminomethylideneamino)oxy-N-methyl-2-[6-methyl-3-[(3-methylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)C(C(C)ON=C(N)N)n1c(C)ccc(NS(=O)(=O)c2cccc(C)c2)c1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26N6O5S.C2HF3O2/c1-11-6-5-7-14(10-11)31(28,29)24-15-9-8-12(2)25(18(15)27)16(17(26)22-4)13(3)30-23-19(20)21;3-2(4,5)1(6)7/h5-10,13,16,24H,1-4H3,(H,22,26)(H4,20,21,23);(H,6,7) |
| InChIKey | JIDDFOOAAJKZGW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 208.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|