C20H22F6N6O7S — CID 22178616
3-(diaminomethylideneamino)oxy-2-[6-methyl-2-oxo-3-[[2-(trifluoromethyl)phenyl]sulfonylamino]-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid (PubChem CID 22178616) has the molecular formula C20H22F6N6O7S and a molecular weight of 604.49 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)oxy-2-[6-methyl-2-oxo-3-[[2-(trifluoromethyl)phenyl]sulfonylamino]-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(diaminomethylideneamino)oxy-2-[6-methyl-2-oxo-3-[[2-(trifluoromethyl)phenyl]sulfonylamino]-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22178616 |
| Molecular Formula | C20H22F6N6O7S |
| Molecular Weight | 604.49 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | 3-(diaminomethylideneamino)oxy-2-[6-methyl-2-oxo-3-[[2-(trifluoromethyl)phenyl]sulfonylamino]-1-pyridinyl]butanamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccccc2C(F)(F)F)c(=O)n1C(C(N)=O)C(C)ON=C(N)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21F3N6O5S.C2HF3O2/c1-9-7-8-12(16(29)27(9)14(15(22)28)10(2)32-25-17(23)24)26-33(30,31)13-6-4-3-5-11(13)18(19,20)21;3-2(4,5)1(6)7/h3-8,10,14,26H,1-2H3,(H2,22,28)(H4,23,24,25);(H,6,7) |
| InChIKey | RFEXQIIYIASREH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 222.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|