C20H25F3N6O9S2 — CID 22178705
N-[2-(diaminomethylideneamino)oxyethyl]-2-[6-methyl-3-[(2-methylsulfonylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 22178705) has the molecular formula C20H25F3N6O9S2 and a molecular weight of 614.58 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)oxyethyl]-2-[6-methyl-3-[(2-methylsulfonylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[6-methyl-3-[(2-methylsulfonylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22178705 |
| Molecular Formula | C20H25F3N6O9S2 |
| Molecular Weight | 614.58 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[6-methyl-3-[(2-methylsulfonylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccccc2S(C)(=O)=O)c(=O)n1CC(=O)NCCON=C(N)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24N6O7S2.C2HF3O2/c1-12-7-8-13(17(26)24(12)11-16(25)21-9-10-31-22-18(19)20)23-33(29,30)15-6-4-3-5-14(15)32(2,27)28;3-2(4,5)1(6)7/h3-8,23H,9-11H2,1-2H3,(H,21,25)(H4,19,20,22);(H,6,7) |
| InChIKey | KXBZAMAFSWWDLG-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 242.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.58 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|