About 1,1-dicyclohexylpentane-1,5-diol
1,1-dicyclohexylpentane-1,5-diol (PubChem CID 22179017) has the molecular formula C17H32O2
and a molecular weight of 268.44 g/mol. Its IUPAC name is 1,1-dicyclohexylpentane-1,5-diol.
Molecular Properties
| Compound Name | 1,1-dicyclohexylpentane-1,5-diol |
| PubChem CID | 22179017 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 1,1-dicyclohexylpentane-1,5-diol |
| SMILES | OCCCCC(O)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H32O2/c18-14-8-7-13-17(19,15-9-3-1-4-10-15)16-11-5-2-6-12-16/h15-16,18-19H,1-14H2 |
| InChIKey | ZDIZKLRNQNPWQR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dicyclohexylpentane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dicyclohexylpentane-1,5-diol?
The IUPAC name of 1,1-dicyclohexylpentane-1,5-diol (CID 22179017) is 1,1-dicyclohexylpentane-1,5-diol.
What is the SMILES notation for 1,1-dicyclohexylpentane-1,5-diol?
The canonical SMILES for 1,1-dicyclohexylpentane-1,5-diol is OCCCCC(O)(C1CCCCC1)C1CCCCC1.
What is the InChIKey of 1,1-dicyclohexylpentane-1,5-diol?
The InChIKey is ZDIZKLRNQNPWQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O2/c18-14-8-7-13-17(19,15-9-3-1-4-10-15)16-11-5-2-6-12-16/h15-16,18-19H,1-14H2.
What are the key properties of 1,1-dicyclohexylpentane-1,5-diol?
1,1-dicyclohexylpentane-1,5-diol has a molecular weight of 268.44 g/mol, XLogP of 4.04, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dicyclohexylpentane-1,5-diol is sourced from PubChem (CID 22179017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).