About ethane-1,2-diol;propane-1,1-diol
ethane-1,2-diol;propane-1,1-diol (PubChem CID 22179149) has the molecular formula C5H14O4
and a molecular weight of 138.16 g/mol. Its IUPAC name is ethane-1,2-diol;propane-1,1-diol.
Molecular Properties
| Compound Name | ethane-1,2-diol;propane-1,1-diol |
| PubChem CID | 22179149 |
| Molecular Formula | C5H14O4 |
| Molecular Weight | 138.16 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | ethane-1,2-diol;propane-1,1-diol |
| SMILES | CCC(O)O.OCCO |
| InChI | InChI=1S/C3H8O2.C2H6O2/c1-2-3(4)5;3-1-2-4/h3-5H,2H2,1H3;3-4H,1-2H2 |
| InChIKey | WJWQFJUSBPEZAO-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.16 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diol;propane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;propane-1,1-diol?
The IUPAC name of ethane-1,2-diol;propane-1,1-diol (CID 22179149) is ethane-1,2-diol;propane-1,1-diol.
What is the SMILES notation for ethane-1,2-diol;propane-1,1-diol?
The canonical SMILES for ethane-1,2-diol;propane-1,1-diol is CCC(O)O.OCCO.
What is the InChIKey of ethane-1,2-diol;propane-1,1-diol?
The InChIKey is WJWQFJUSBPEZAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.C2H6O2/c1-2-3(4)5;3-1-2-4/h3-5H,2H2,1H3;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;propane-1,1-diol?
ethane-1,2-diol;propane-1,1-diol has a molecular weight of 138.16 g/mol, XLogP of -1.32, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;propane-1,1-diol is sourced from PubChem (CID 22179149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).