About dibenzofuran-3-sulfonyl chloride
dibenzofuran-3-sulfonyl chloride (PubChem CID 22179305) has the molecular formula C12H7ClO3S
and a molecular weight of 266.70 g/mol. Its IUPAC name is dibenzofuran-3-sulfonyl chloride.
Molecular Properties
| Compound Name | dibenzofuran-3-sulfonyl chloride |
| PubChem CID | 22179305 |
| Molecular Formula | C12H7ClO3S |
| Molecular Weight | 266.70 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | dibenzofuran-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C12H7ClO3S/c13-17(14,15)8-5-6-10-9-3-1-2-4-11(9)16-12(10)7-8/h1-7H |
| InChIKey | CGJNXSWIIBSXII-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.70 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dibenzofuran-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran-3-sulfonyl chloride?
The IUPAC name of dibenzofuran-3-sulfonyl chloride (CID 22179305) is dibenzofuran-3-sulfonyl chloride.
What is the SMILES notation for dibenzofuran-3-sulfonyl chloride?
The canonical SMILES for dibenzofuran-3-sulfonyl chloride is O=S(=O)(Cl)c1ccc2c(c1)oc1ccccc12.
What is the InChIKey of dibenzofuran-3-sulfonyl chloride?
The InChIKey is CGJNXSWIIBSXII-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClO3S/c13-17(14,15)8-5-6-10-9-3-1-2-4-11(9)16-12(10)7-8/h1-7H.
What are the key properties of dibenzofuran-3-sulfonyl chloride?
dibenzofuran-3-sulfonyl chloride has a molecular weight of 266.70 g/mol, XLogP of 3.51, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran-3-sulfonyl chloride is sourced from PubChem (CID 22179305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).