About 4-hydroxybutylurea
4-hydroxybutylurea (PubChem CID 22179648) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is 4-hydroxybutylurea.
Molecular Properties
| Compound Name | 4-hydroxybutylurea |
| PubChem CID | 22179648 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 4-hydroxybutylurea |
| SMILES | NC(=O)NCCCCO |
| InChI | InChI=1S/C5H12N2O2/c6-5(9)7-3-1-2-4-8/h8H,1-4H2,(H3,6,7,9) |
| InChIKey | ANHWXVYLXIJYMY-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutylurea?
The IUPAC name of 4-hydroxybutylurea (CID 22179648) is 4-hydroxybutylurea.
What is the SMILES notation for 4-hydroxybutylurea?
The canonical SMILES for 4-hydroxybutylurea is NC(=O)NCCCCO.
What is the InChIKey of 4-hydroxybutylurea?
The InChIKey is ANHWXVYLXIJYMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2/c6-5(9)7-3-1-2-4-8/h8H,1-4H2,(H3,6,7,9).
What are the key properties of 4-hydroxybutylurea?
4-hydroxybutylurea has a molecular weight of 132.16 g/mol, XLogP of -0.57, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutylurea is sourced from PubChem (CID 22179648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).