C27H28ClN5O2 — CID 22180034
N-(3-aminopropyl)-N-[1-(3-benzyl-5-chloro-4-oxopyrrolo[2,1-f][1,2,4]triazin-2-yl)prop-2-enyl]-4-methylbenzamide (PubChem CID 22180034) has the molecular formula C27H28ClN5O2 and a molecular weight of 490.01 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[1-(3-benzyl-5-chloro-4-oxopyrrolo[2,1-f][1,2,4]triazin-2-yl)prop-2-enyl]-4-methylbenzamide.
| Compound Name | N-(3-aminopropyl)-N-[1-(3-benzyl-5-chloro-4-oxopyrrolo[2,1-f][1,2,4]triazin-2-yl)prop-2-enyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 22180034 |
| Molecular Formula | C27H28ClN5O2 |
| Molecular Weight | 490.01 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | N-(3-aminopropyl)-N-[1-(3-benzyl-5-chloro-4-oxopyrrolo[2,1-f][1,2,4]triazin-2-yl)prop-2-enyl]-4-methylbenzamide |
| SMILES | C=CC(c1nn2ccc(Cl)c2c(=O)n1Cc1ccccc1)N(CCCN)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H28ClN5O2/c1-3-23(31(16-7-15-29)26(34)21-12-10-19(2)11-13-21)25-30-33-17-14-22(28)24(33)27(35)32(25)18-20-8-5-4-6-9-20/h3-6,8-14,17,23H,1,7,15-16,18,29H2,2H3 |
| InChIKey | RAIFAMGTXAXRQZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.01 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|