C33H35F4N3O3 — CID 22180200
ethyl 2-fluoro-4-[4-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperazin-1-yl]benzoate (PubChem CID 22180200) has the molecular formula C33H35F4N3O3 and a molecular weight of 597.65 g/mol. Its IUPAC name is ethyl 2-fluoro-4-[4-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperazin-1-yl]benzoate.
| Compound Name | ethyl 2-fluoro-4-[4-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 22180200 |
| Molecular Formula | C33H35F4N3O3 |
| Molecular Weight | 597.65 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | ethyl 2-fluoro-4-[4-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCN(CCCCC3(C(=O)NCC(F)(F)F)c4ccccc4-c4ccccc43)CC2)cc1F |
| InChI | InChI=1S/C33H35F4N3O3/c1-2-43-30(41)26-14-13-23(21-29(26)34)40-19-17-39(18-20-40)16-8-7-15-32(31(42)38-22-33(35,36)37)27-11-5-3-9-24(27)25-10-4-6-12-28(25)32/h3-6,9-14,21H,2,7-8,15-20,22H2,1H3,(H,38,42) |
| InChIKey | YOEMYOCLVBQYEE-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|