About N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide
N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide (PubChem CID 22180258) has the molecular formula C37H43N3O
and a molecular weight of 545.77 g/mol. Its IUPAC name is N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide.
Molecular Properties
| Compound Name | N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide |
| PubChem CID | 22180258 |
| Molecular Formula | C37H43N3O |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide |
| SMILES | Cc1ccc(N2CCN(CCC(c3ccccc3)c3ccccc3)CC2)cc1C(=O)N(Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C37H43N3O/c1-29(2)40(28-31-13-7-4-8-14-31)37(41)36-27-34(20-19-30(36)3)39-25-23-38(24-26-39)22-21-35(32-15-9-5-10-16-32)33-17-11-6-12-18-33/h4-20,27,29,35H,21-26,28H2,1-3H3 |
| InChIKey | WWYJFPBNTFLISQ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide?
The IUPAC name of N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide (CID 22180258) is N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide.
What is the SMILES notation for N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide?
The canonical SMILES for N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide is Cc1ccc(N2CCN(CCC(c3ccccc3)c3ccccc3)CC2)cc1C(=O)N(Cc1ccccc1)C(C)C.
What is the InChIKey of N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide?
The InChIKey is WWYJFPBNTFLISQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H43N3O/c1-29(2)40(28-31-13-7-4-8-14-31)37(41)36-27-34(20-19-30(36)3)39-25-23-38(24-26-39)22-21-35(32-15-9-5-10-16-32)33-17-11-6-12-18-33/h4-20,27,29,35H,21-26,28H2,1-3H3.
What are the key properties of N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide?
N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide has a molecular weight of 545.77 g/mol, XLogP of 7.39, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-[4-(3,3-diphenylpropyl)piperazin-1-yl]-2-methyl-N-propan-2-ylbenzamide is sourced from PubChem (CID 22180258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).