C8H12BNO2S — CID 22180767
4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,2-thiazole (PubChem CID 22180767) has the molecular formula C8H12BNO2S and a molecular weight of 197.07 g/mol. Its IUPAC name is 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,2-thiazole.
| Compound Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,2-thiazole |
|---|---|
| PubChem CID | 22180767 |
| Molecular Formula | C8H12BNO2S |
| Molecular Weight | 197.07 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,2-thiazole |
| SMILES | CC1(C)COB(c2cnsc2)OC1 |
| InChI | InChI=1S/C8H12BNO2S/c1-8(2)5-11-9(12-6-8)7-3-10-13-4-7/h3-4H,5-6H2,1-2H3 |
| InChIKey | OXYTYYYUACZTIU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.07 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|