C14H16BNO2S — CID 22180774
3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)thiophen-2-yl]pyridine (PubChem CID 22180774) has the molecular formula C14H16BNO2S and a molecular weight of 273.17 g/mol. Its IUPAC name is 3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)thiophen-2-yl]pyridine.
| Compound Name | 3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)thiophen-2-yl]pyridine |
|---|---|
| PubChem CID | 22180774 |
| Molecular Formula | C14H16BNO2S |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)thiophen-2-yl]pyridine |
| SMILES | CC1(C)COB(c2csc(-c3cccnc3)c2)OC1 |
| InChI | InChI=1S/C14H16BNO2S/c1-14(2)9-17-15(18-10-14)12-6-13(19-8-12)11-4-3-5-16-7-11/h3-8H,9-10H2,1-2H3 |
| InChIKey | VRKZERASOLJBNJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|