C11H22O5 — CID 22180792
1,1-diethoxy-4,4-dimethoxypentan-3-one (PubChem CID 22180792) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is 1,1-diethoxy-4,4-dimethoxypentan-3-one.
| Compound Name | 1,1-diethoxy-4,4-dimethoxypentan-3-one |
|---|---|
| PubChem CID | 22180792 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1,1-diethoxy-4,4-dimethoxypentan-3-one |
| SMILES | CCOC(CC(=O)C(C)(OC)OC)OCC |
| InChI | InChI=1S/C11H22O5/c1-6-15-10(16-7-2)8-9(12)11(3,13-4)14-5/h10H,6-8H2,1-5H3 |
| InChIKey | CROQKNMBSFZGQX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|