About 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine
4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine (PubChem CID 22180913) has the molecular formula C13H20N4
and a molecular weight of 232.33 g/mol. Its IUPAC name is 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine.
Molecular Properties
| Compound Name | 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine |
| PubChem CID | 22180913 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine |
| SMILES | CC(C)c1c(N)c(C(C)C)c2ccnn2c1N |
| InChI | InChI=1S/C13H20N4/c1-7(2)10-9-5-6-16-17(9)13(15)11(8(3)4)12(10)14/h5-8H,14-15H2,1-4H3 |
| InChIKey | RSFYWMBSEZGDOQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine?
The IUPAC name of 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine (CID 22180913) is 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine.
What is the SMILES notation for 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine?
The canonical SMILES for 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine is CC(C)c1c(N)c(C(C)C)c2ccnn2c1N.
What is the InChIKey of 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine?
The InChIKey is RSFYWMBSEZGDOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4/c1-7(2)10-9-5-6-16-17(9)13(15)11(8(3)4)12(10)14/h5-8H,14-15H2,1-4H3.
What are the key properties of 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine?
4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine has a molecular weight of 232.33 g/mol, XLogP of 2.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-di(propan-2-yl)pyrazolo[1,5-a]pyridine-5,7-diamine is sourced from PubChem (CID 22180913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).