About 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride
1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride (PubChem CID 22181) has the molecular formula C8H11ClN4O2
and a molecular weight of 230.66 g/mol. Its IUPAC name is 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride.
Molecular Properties
| Compound Name | 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride |
| PubChem CID | 22181 |
| Molecular Formula | C8H11ClN4O2 |
| Molecular Weight | 230.66 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)[NH+](C)C=N2.[Cl-] |
| InChI | InChI=1S/C8H10N4O2.ClH/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;/h4H,1-3H3;1H |
| InChIKey | VDHPYBVMFNLZQG-UHFFFAOYSA-N |
| XLogP | -5.09 |
| TPSA | 60.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.66 |
| LogP ≤ 5 | -5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride?
The IUPAC name of 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride (CID 22181) is 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride.
What is the SMILES notation for 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride?
The canonical SMILES for 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride is Cn1c2c(c(=O)n(C)c1=O)[NH+](C)C=N2.[Cl-].
What is the InChIKey of 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride?
The InChIKey is VDHPYBVMFNLZQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2.ClH/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;/h4H,1-3H3;1H.
What are the key properties of 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride?
1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride has a molecular weight of 230.66 g/mol, XLogP of -5.09, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione chloride is sourced from PubChem (CID 22181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).