C27H37Cl3N4O5S — CID 22181142
ethyl 2-[[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]-[3-chloro-4-(1,2-dimethylpiperidin-4-yl)oxyphenyl]sulfamoyl]acetate;dihydrochloride (PubChem CID 22181142) has the molecular formula C27H37Cl3N4O5S and a molecular weight of 636.04 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]-[3-chloro-4-(1,2-dimethylpiperidin-4-yl)oxyphenyl]sulfamoyl]acetate;dihydrochloride.
| Compound Name | ethyl 2-[[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]-[3-chloro-4-(1,2-dimethylpiperidin-4-yl)oxyphenyl]sulfamoyl]acetate;dihydrochloride |
|---|---|
| PubChem CID | 22181142 |
| Molecular Formula | C27H37Cl3N4O5S |
| Molecular Weight | 636.04 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | ethyl 2-[[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]-[3-chloro-4-(1,2-dimethylpiperidin-4-yl)oxyphenyl]sulfamoyl]acetate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1cccc(/C=C/CN(c2ccc(OC3CCN(C)C(C)C3)c(Cl)c2)S(=O)(=O)CC(=O)OCC)c1 |
| InChI | InChI=1S/C27H35ClN4O5S.2ClH/c1-4-36-26(33)18-38(34,35)32(13-6-8-20-7-5-9-21(16-20)27(29)30)22-10-11-25(24(28)17-22)37-23-12-14-31(3)19(2)15-23;;/h5-11,16-17,19,23H,4,12-15,18H2,1-3H3,(H3,29,30);2*1H/b8-6+;; |
| InChIKey | JUJYKMACRBHYRE-OVGXCEQFSA-N |
| XLogP | 4.74 |
| TPSA | 126.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.04 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|